C13H15F6O3S- — CID 140732289
3-(1-adamantyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate (PubChem CID 140732289) has the molecular formula C13H15F6O3S- and a molecular weight of 365.32 g/mol. Its IUPAC name is 3-(1-adamantyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | 3-(1-adamantyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 140732289 |
| Molecular Formula | C13H15F6O3S- |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3-(1-adamantyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H16F6O3S/c14-11(15,12(16,17)13(18,19)23(20,21)22)10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2,(H,20,21,22)/p-1 |
| InChIKey | XWMOBGTWANDRSV-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|