C10H11ClN2O — CID 59471428
(6-chloro-1-ethylpyrrolo[2,3-b]pyridin-2-yl)methanol (PubChem CID 59471428) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is (6-chloro-1-ethylpyrrolo[2,3-b]pyridin-2-yl)methanol.
| Compound Name | (6-chloro-1-ethylpyrrolo[2,3-b]pyridin-2-yl)methanol |
|---|---|
| PubChem CID | 59471428 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (6-chloro-1-ethylpyrrolo[2,3-b]pyridin-2-yl)methanol |
| SMILES | CCn1c(CO)cc2ccc(Cl)nc21 |
| InChI | InChI=1S/C10H11ClN2O/c1-2-13-8(6-14)5-7-3-4-9(11)12-10(7)13/h3-5,14H,2,6H2,1H3 |
| InChIKey | MHCXRAOMNQMFFB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|