C9H7ClN2O — CID 141368895
1-(6-chloropyrrolo[2,3-b]pyridin-1-yl)ethanone (PubChem CID 141368895) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 1-(6-chloropyrrolo[2,3-b]pyridin-1-yl)ethanone.
| Compound Name | 1-(6-chloropyrrolo[2,3-b]pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 141368895 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 1-(6-chloropyrrolo[2,3-b]pyridin-1-yl)ethanone |
| SMILES | CC(=O)n1ccc2ccc(Cl)nc21 |
| InChI | InChI=1S/C9H7ClN2O/c1-6(13)12-5-4-7-2-3-8(10)11-9(7)12/h2-5H,1H3 |
| InChIKey | LZZODCFXMIWGAY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|