C10H10N2O2 — CID 141368874
1-(6-methoxypyrrolo[2,3-b]pyridin-1-yl)ethanone (PubChem CID 141368874) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-(6-methoxypyrrolo[2,3-b]pyridin-1-yl)ethanone.
| Compound Name | 1-(6-methoxypyrrolo[2,3-b]pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 141368874 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(6-methoxypyrrolo[2,3-b]pyridin-1-yl)ethanone |
| SMILES | COc1ccc2ccn(C(C)=O)c2n1 |
| InChI | InChI=1S/C10H10N2O2/c1-7(13)12-6-5-8-3-4-9(14-2)11-10(8)12/h3-6H,1-2H3 |
| InChIKey | DITVHNDIPJXWHR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |