C16H12N5O — CID 59472039
CID 59472039 (PubChem CID 59472039) has the molecular formula C16H12N5O and a molecular weight of 290.31 g/mol.
| Compound Name | CID 59472039 |
|---|---|
| PubChem CID | 59472039 |
| Molecular Formula | C16H12N5O |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | — |
| SMILES | [NH]c1ncc(-c2cccnc2)nc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H12N5O/c17-15-14(16(22)20-12-6-2-1-3-7-12)21-13(10-19-15)11-5-4-8-18-9-11/h1-10,17H,(H,20,22) |
| InChIKey | HBCCVPMAXBSRKS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |