C24H30F3N7O2 — CID 59472796
(3S,5S)-5-tert-butyl-3-[4-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)azepan-2-one (PubChem CID 59472796) has the molecular formula C24H30F3N7O2 and a molecular weight of 505.55 g/mol. Its IUPAC name is (3S,5S)-5-tert-butyl-3-[4-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)azepan-2-one.
| Compound Name | (3S,5S)-5-tert-butyl-3-[4-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)azepan-2-one |
|---|---|
| PubChem CID | 59472796 |
| Molecular Formula | C24H30F3N7O2 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | (3S,5S)-5-tert-butyl-3-[4-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]triazol-1-yl]-1-(2,2,2-trifluoroethyl)azepan-2-one |
| SMILES | COc1cc(-c2cn([C@H]3C[C@@H](C(C)(C)C)CCN(CC(F)(F)F)C3=O)nn2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C24H30F3N7O2/c1-15-28-14-34(30-15)19-7-6-16(10-21(19)36-5)18-12-33(31-29-18)20-11-17(23(2,3)4)8-9-32(22(20)35)13-24(25,26)27/h6-7,10,12,14,17,20H,8-9,11,13H2,1-5H3/t17-,20-/m0/s1 |
| InChIKey | CNZDACAYNPIXPW-PXNSSMCTSA-N |
| XLogP | 4.23 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |