C31H26N8O7S2 — CID 59476165
2-[4-[[4-[(4-amino-2,5-dimethylphenyl)diazenyl]-2-methylphenyl]diazenyl]-2-hydroxyphenyl]-6-(trioxidanylsulfanyl)benzo[e]benzotriazole-8-sulfonic acid (PubChem CID 59476165) has the molecular formula C31H26N8O7S2 and a molecular weight of 686.73 g/mol. Its IUPAC name is 2-[4-[[4-[(4-amino-2,5-dimethylphenyl)diazenyl]-2-methylphenyl]diazenyl]-2-hydroxyphenyl]-6-(trioxidanylsulfanyl)benzo[e]benzotriazole-8-sulfonic acid.
| Compound Name | 2-[4-[[4-[(4-amino-2,5-dimethylphenyl)diazenyl]-2-methylphenyl]diazenyl]-2-hydroxyphenyl]-6-(trioxidanylsulfanyl)benzo[e]benzotriazole-8-sulfonic acid |
|---|---|
| PubChem CID | 59476165 |
| Molecular Formula | C31H26N8O7S2 |
| Molecular Weight | 686.73 g/mol |
| Exact Mass | 686.14 |
| IUPAC Name | 2-[4-[[4-[(4-amino-2,5-dimethylphenyl)diazenyl]-2-methylphenyl]diazenyl]-2-hydroxyphenyl]-6-(trioxidanylsulfanyl)benzo[e]benzotriazole-8-sulfonic acid |
| SMILES | Cc1cc(/N=N/c2ccc(/N=N/c3ccc(-n4nc5ccc6c(SOOO)cc(S(=O)(=O)O)cc6c5n4)c(O)c3)c(C)c2)c(C)cc1N |
| InChI | InChI=1S/C31H26N8O7S2/c1-16-12-27(18(3)11-24(16)32)36-33-19-4-7-25(17(2)10-19)35-34-20-5-9-28(29(40)13-20)39-37-26-8-6-22-23(31(26)38-39)14-21(48(42,43)44)15-30(22)47-46-45-41/h4-15,40-41H,32H2,1-3H3,(H,42,43,44)/b35-34+,36-33+ |
| InChIKey | JCXGMQDYKATZAM-SJMAOBPSSA-N |
| XLogP | 8.29 |
| TPSA | 219.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.73 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|