C31H24N6O12S4 — CID 58880546
5-[[4-(sulfomethylamino)phenyl]diazenyl]-2-[2-[2-sulfo-4-[5-(trioxidanylsulfanyl)benzo[e]benzotriazol-2-yl]phenyl]ethenyl]benzenesulfonic acid (PubChem CID 58880546) has the molecular formula C31H24N6O12S4 and a molecular weight of 800.83 g/mol. Its IUPAC name is 5-[[4-(sulfomethylamino)phenyl]diazenyl]-2-[2-[2-sulfo-4-[5-(trioxidanylsulfanyl)benzo[e]benzotriazol-2-yl]phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[[4-(sulfomethylamino)phenyl]diazenyl]-2-[2-[2-sulfo-4-[5-(trioxidanylsulfanyl)benzo[e]benzotriazol-2-yl]phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58880546 |
| Molecular Formula | C31H24N6O12S4 |
| Molecular Weight | 800.83 g/mol |
| Exact Mass | 800.03 |
| IUPAC Name | 5-[[4-(sulfomethylamino)phenyl]diazenyl]-2-[2-[2-sulfo-4-[5-(trioxidanylsulfanyl)benzo[e]benzotriazol-2-yl]phenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)CNc1ccc(/N=N/c2ccc(C=Cc3ccc(-n4nc5cc(SOOO)c6ccccc6c5n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C31H24N6O12S4/c38-48-49-50-28-17-27-31(26-4-2-1-3-25(26)28)36-37(35-27)24-14-8-20(30(16-24)53(45,46)47)6-5-19-7-9-23(15-29(19)52(42,43)44)34-33-22-12-10-21(11-13-22)32-18-51(39,40)41/h1-17,32,38H,18H2,(H,39,40,41)(H,42,43,44)(H,45,46,47)/b6-5?,34-33+ |
| InChIKey | XFVREYXJCLSLMR-ACOBRAGZSA-N |
| XLogP | 6.34 |
| TPSA | 269.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.83 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|