C33H28N8O8S2 — CID 88853433
5-[[4-[(4-amino-2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl]diazenyl]-2-(6,8-disulfobenzo[e]benzotriazol-2-yl)benzoic acid (PubChem CID 88853433) has the molecular formula C33H28N8O8S2 and a molecular weight of 728.77 g/mol. Its IUPAC name is 5-[[4-[(4-amino-2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl]diazenyl]-2-(6,8-disulfobenzo[e]benzotriazol-2-yl)benzoic acid.
| Compound Name | 5-[[4-[(4-amino-2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl]diazenyl]-2-(6,8-disulfobenzo[e]benzotriazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 88853433 |
| Molecular Formula | C33H28N8O8S2 |
| Molecular Weight | 728.77 g/mol |
| Exact Mass | 728.15 |
| IUPAC Name | 5-[[4-[(4-amino-2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl]diazenyl]-2-(6,8-disulfobenzo[e]benzotriazol-2-yl)benzoic acid |
| SMILES | Cc1cc(/N=N/c2cc(C)c(/N=N/c3ccc(-n4nc5ccc6c(S(=O)(=O)O)cc(S(=O)(=O)O)cc6c5n4)c(C(=O)O)c3)cc2C)c(C)cc1N |
| InChI | InChI=1S/C33H28N8O8S2/c1-16-10-27(17(2)9-25(16)34)37-38-29-12-18(3)28(11-19(29)4)36-35-20-5-8-30(24(13-20)33(42)43)41-39-26-7-6-22-23(32(26)40-41)14-21(50(44,45)46)15-31(22)51(47,48)49/h5-15H,34H2,1-4H3,(H,42,43)(H,44,45,46)(H,47,48,49)/b36-35+,38-37+ |
| InChIKey | YVYYYYKXKDYJLS-JKWOPUAESA-N |
| XLogP | 7.41 |
| TPSA | 252.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.77 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|