2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid

C12H23NO2S — CID 594774

IUPAC2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid
SMILESCCCCCCC1NC(C(=O)O)C(C)(C)S1
InChIInChI=1S/C12H23NO2S/c1-4-5-6-7-8-9-13-10(11(14)15)12(2,3)16-9/h9-10,13H,4-8H2,1-3H3,(H,14,15)
InChIKeyVIJZAZQAOGXKRB-UHFFFAOYSA-N
MW245.39 g/mol
LogP2.85
Rot. Bonds6

About 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid

2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 594774) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid
PubChem CID594774
Molecular FormulaC12H23NO2S
Molecular Weight245.39 g/mol
Exact Mass245.14
IUPAC Name2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid
SMILESCCCCCCC1NC(C(=O)O)C(C)(C)S1
InChIInChI=1S/C12H23NO2S/c1-4-5-6-7-8-9-13-10(11(14)15)12(2,3)16-9/h9-10,13H,4-8H2,1-3H3,(H,14,15)
InChIKeyVIJZAZQAOGXKRB-UHFFFAOYSA-N
XLogP2.85
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.39
LogP ≤ 52.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CID 594774) is 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid is CCCCCCC1NC(C(=O)O)C(C)(C)S1.
What is the InChIKey of 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is VIJZAZQAOGXKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2S/c1-4-5-6-7-8-9-13-10(11(14)15)12(2,3)16-9/h9-10,13H,4-8H2,1-3H3,(H,14,15).
What are the key properties of 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid?
2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 245.39 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 594774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).