C14H25N3 — CID 59483793
1,7-ditert-butyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine (PubChem CID 59483793) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 1,7-ditert-butyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine.
| Compound Name | 1,7-ditert-butyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 59483793 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 1,7-ditert-butyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
| SMILES | CC(C)(C)c1ncn2c1CN(C(C)(C)C)CC2 |
| InChI | InChI=1S/C14H25N3/c1-13(2,3)12-11-9-17(14(4,5)6)8-7-16(11)10-15-12/h10H,7-9H2,1-6H3 |
| InChIKey | HSXIYQSSMGICGO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |