C20H26N2O3S — CID 59485320
3-[4-[ethyl-(4-oxo-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[e][1,3]thiazin-2-yl)amino]phenyl]propanoic acid (PubChem CID 59485320) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 3-[4-[ethyl-(4-oxo-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[e][1,3]thiazin-2-yl)amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[ethyl-(4-oxo-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[e][1,3]thiazin-2-yl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59485320 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-[4-[ethyl-(4-oxo-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[e][1,3]thiazin-2-yl)amino]phenyl]propanoic acid |
| SMILES | CCN(C1=NC(=O)C2CCCCCC2S1)c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-2-22(15-11-8-14(9-12-15)10-13-18(23)24)20-21-19(25)16-6-4-3-5-7-17(16)26-20/h8-9,11-12,16-17H,2-7,10,13H2,1H3,(H,23,24) |
| InChIKey | HTSVKSOLOSWYLI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |