C17H22N2OS — CID 59485292
2-(N-ethylanilino)-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[e][1,3]thiazin-4-one (PubChem CID 59485292) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-(N-ethylanilino)-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[e][1,3]thiazin-4-one.
| Compound Name | 2-(N-ethylanilino)-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 59485292 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-(N-ethylanilino)-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[e][1,3]thiazin-4-one |
| SMILES | CCN(C1=NC(=O)C2CCCCCC2S1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2OS/c1-2-19(13-9-5-3-6-10-13)17-18-16(20)14-11-7-4-8-12-15(14)21-17/h3,5-6,9-10,14-15H,2,4,7-8,11-12H2,1H3 |
| InChIKey | YLCZRFHWULCITO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |