C12H17N3O2S — CID 594854
N,1-diethyl-2-methylbenzimidazole-5-sulfonimidic acid (PubChem CID 594854) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N,1-diethyl-2-methylbenzimidazole-5-sulfonimidic acid.
| Compound Name | N,1-diethyl-2-methylbenzimidazole-5-sulfonimidic acid |
|---|---|
| PubChem CID | 594854 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N,1-diethyl-2-methylbenzimidazole-5-sulfonimidic acid |
| SMILES | CCN=S(=O)(O)c1ccc2c(c1)nc(C)n2CC |
| InChI | InChI=1S/C12H17N3O2S/c1-4-13-18(16,17)10-6-7-12-11(8-10)14-9(3)15(12)5-2/h6-8H,4-5H2,1-3H3,(H,13,16,17) |
| InChIKey | VXDAPJCHDIYRHV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |