C15H13Cl2O2P — CID 59489047
2-dichlorophosphoryloxy-9,9-dimethylfluorene (PubChem CID 59489047) has the molecular formula C15H13Cl2O2P and a molecular weight of 327.15 g/mol. Its IUPAC name is 2-dichlorophosphoryloxy-9,9-dimethylfluorene.
| Compound Name | 2-dichlorophosphoryloxy-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 59489047 |
| Molecular Formula | C15H13Cl2O2P |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 2-dichlorophosphoryloxy-9,9-dimethylfluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc(OP(=O)(Cl)Cl)cc21 |
| InChI | InChI=1S/C15H13Cl2O2P/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(9-14(12)15)19-20(16,17)18/h3-9H,1-2H3 |
| InChIKey | AGRNYLBXNHXLMX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|