C29H21Cl2N3O3 — CID 59489938
(2-methoxyphenyl)methyl N-[6-(3,4-dichlorophenyl)-1-isocyano-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate (PubChem CID 59489938) has the molecular formula C29H21Cl2N3O3 and a molecular weight of 530.41 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl N-[6-(3,4-dichlorophenyl)-1-isocyano-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate.
| Compound Name | (2-methoxyphenyl)methyl N-[6-(3,4-dichlorophenyl)-1-isocyano-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate |
|---|---|
| PubChem CID | 59489938 |
| Molecular Formula | C29H21Cl2N3O3 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | (2-methoxyphenyl)methyl N-[6-(3,4-dichlorophenyl)-1-isocyano-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate |
| SMILES | [C-]#[N+]c1c(NC(=O)OCc2ccccc2OC)ncc2c1-c1ccccc1C(c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C29H21Cl2N3O3/c1-32-27-26-19(15-33-28(27)34-29(35)37-16-18-7-3-6-10-25(18)36-2)13-22(20-8-4-5-9-21(20)26)17-11-12-23(30)24(31)14-17/h3-12,14-15,22H,13,16H2,2H3,(H,33,34,35) |
| InChIKey | DWHLIDLNVZHZPA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 64.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|