C25H21Cl2N3O2 — CID 67541419
butyl N-[1-cyano-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate (PubChem CID 67541419) has the molecular formula C25H21Cl2N3O2 and a molecular weight of 466.37 g/mol. Its IUPAC name is butyl N-[1-cyano-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate.
| Compound Name | butyl N-[1-cyano-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate |
|---|---|
| PubChem CID | 67541419 |
| Molecular Formula | C25H21Cl2N3O2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | butyl N-[1-cyano-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1ncc2c(c1C#N)-c1ccccc1C(c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C25H21Cl2N3O2/c1-2-3-10-32-25(31)30-24-20(13-28)23-16(14-29-24)11-19(17-6-4-5-7-18(17)23)15-8-9-21(26)22(27)12-15/h4-9,12,14,19H,2-3,10-11H2,1H3,(H,29,30,31) |
| InChIKey | QXMZVVRDNJVKGP-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|