C29H20Cl3N3O2 — CID 91015581
(2-chloro-2-phenylethyl) N-[1-cyano-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate (PubChem CID 91015581) has the molecular formula C29H20Cl3N3O2 and a molecular weight of 548.86 g/mol. Its IUPAC name is (2-chloro-2-phenylethyl) N-[1-cyano-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate.
| Compound Name | (2-chloro-2-phenylethyl) N-[1-cyano-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate |
|---|---|
| PubChem CID | 91015581 |
| Molecular Formula | C29H20Cl3N3O2 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | (2-chloro-2-phenylethyl) N-[1-cyano-6-(3,4-dichlorophenyl)-5,6-dihydrobenzo[f]isoquinolin-2-yl]carbamate |
| SMILES | N#Cc1c(NC(=O)OCC(Cl)c2ccccc2)ncc2c1-c1ccccc1C(c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C29H20Cl3N3O2/c30-24-11-10-18(13-25(24)31)22-12-19-15-34-28(23(14-33)27(19)21-9-5-4-8-20(21)22)35-29(36)37-16-26(32)17-6-2-1-3-7-17/h1-11,13,15,22,26H,12,16H2,(H,34,35,36) |
| InChIKey | JSYPVLDJDNKXRM-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|