C28H47O15P — CID 59492139
diethyl 2-[[[2-(acetyloxymethyl)-3-ethoxy-2-ethoxycarbonyl-3-oxopropoxy]-[[(2S,5S)-3,5-dimethyloxolan-2-yl]methoxy]phosphoryl]oxymethyl]-2-ethylpropanedioate (PubChem CID 59492139) has the molecular formula C28H47O15P and a molecular weight of 654.64 g/mol. Its IUPAC name is diethyl 2-[[[2-(acetyloxymethyl)-3-ethoxy-2-ethoxycarbonyl-3-oxopropoxy]-[[(2S,5S)-3,5-dimethyloxolan-2-yl]methoxy]phosphoryl]oxymethyl]-2-ethylpropanedioate.
| Compound Name | diethyl 2-[[[2-(acetyloxymethyl)-3-ethoxy-2-ethoxycarbonyl-3-oxopropoxy]-[[(2S,5S)-3,5-dimethyloxolan-2-yl]methoxy]phosphoryl]oxymethyl]-2-ethylpropanedioate |
|---|---|
| PubChem CID | 59492139 |
| Molecular Formula | C28H47O15P |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | diethyl 2-[[[2-(acetyloxymethyl)-3-ethoxy-2-ethoxycarbonyl-3-oxopropoxy]-[[(2S,5S)-3,5-dimethyloxolan-2-yl]methoxy]phosphoryl]oxymethyl]-2-ethylpropanedioate |
| SMILES | CCOC(=O)C(CC)(COP(=O)(OC[C@H]1O[C@@H](C)CC1C)OCC(COC(C)=O)(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C28H47O15P/c1-9-27(23(30)35-10-2,24(31)36-11-3)17-41-44(34,40-15-22-19(6)14-20(7)43-22)42-18-28(16-39-21(8)29,25(32)37-12-4)26(33)38-13-5/h19-20,22H,9-18H2,1-8H3/t19?,20-,22+,44?/m0/s1 |
| InChIKey | GINZRGKGAXMMNS-NXEAGOEUSA-N |
| XLogP | 3.16 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|