C21H14F3NO2 — CID 59492496
4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]benzamide (PubChem CID 59492496) has the molecular formula C21H14F3NO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]benzamide.
| Compound Name | 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]benzamide |
|---|---|
| PubChem CID | 59492496 |
| Molecular Formula | C21H14F3NO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc3c(c2)C(O)(C(F)(F)F)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C21H14F3NO2/c22-21(23,24)20(27)17-4-2-1-3-15(17)16-10-9-14(11-18(16)20)12-5-7-13(8-6-12)19(25)26/h1-11,27H,(H2,25,26) |
| InChIKey | FRPWDZCNAXVRHB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |