C17H18ClN3O2 — CID 118717210
N-(diaminomethylidene)-9-ethyl-9-hydroxyfluorene-2-carboxamide;hydrochloride (PubChem CID 118717210) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is N-(diaminomethylidene)-9-ethyl-9-hydroxyfluorene-2-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-9-ethyl-9-hydroxyfluorene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118717210 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(diaminomethylidene)-9-ethyl-9-hydroxyfluorene-2-carboxamide;hydrochloride |
| SMILES | CCC1(O)c2ccccc2-c2ccc(C(=O)N=C(N)N)cc21.Cl |
| InChI | InChI=1S/C17H17N3O2.ClH/c1-2-17(22)13-6-4-3-5-11(13)12-8-7-10(9-14(12)17)15(21)20-16(18)19;/h3-9,22H,2H2,1H3,(H4,18,19,20,21);1H |
| InChIKey | XEABBCMSPCHDTB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|