C18H17N3O2 — CID 11536844
(9S)-N-(diaminomethylidene)spiro[fluorene-9,2'-oxolane]-2-carboxamide (PubChem CID 11536844) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (9S)-N-(diaminomethylidene)spiro[fluorene-9,2'-oxolane]-2-carboxamide.
| Compound Name | (9S)-N-(diaminomethylidene)spiro[fluorene-9,2'-oxolane]-2-carboxamide |
|---|---|
| PubChem CID | 11536844 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (9S)-N-(diaminomethylidene)spiro[fluorene-9,2'-oxolane]-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2c(c1)[C@]1(CCCO1)c1ccccc1-2 |
| InChI | InChI=1S/C18H17N3O2/c19-17(20)21-16(22)11-6-7-13-12-4-1-2-5-14(12)18(15(13)10-11)8-3-9-23-18/h1-2,4-7,10H,3,8-9H2,(H4,19,20,21,22)/t18-/m0/s1 |
| InChIKey | AWJQWLYQYNSCDJ-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|