C15H14ClN3O2 — CID 23151759
N-(diaminomethylidene)-9-hydroxy-9H-fluorene-2-carboxamide;hydrochloride (PubChem CID 23151759) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is N-(diaminomethylidene)-9-hydroxy-9H-fluorene-2-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-9-hydroxy-9H-fluorene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 23151759 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-(diaminomethylidene)-9-hydroxy-9H-fluorene-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1ccc2c(c1)C(O)c1ccccc1-2 |
| InChI | InChI=1S/C15H13N3O2.ClH/c16-15(17)18-14(20)8-5-6-10-9-3-1-2-4-11(9)13(19)12(10)7-8;/h1-7,13,19H,(H4,16,17,18,20);1H |
| InChIKey | KJPICQIEXXARFA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|