C18H20ClN3O3 — CID 118717216
N-(diaminomethylidene)-9-methoxy-9-(methoxymethyl)fluorene-2-carboxamide;hydrochloride (PubChem CID 118717216) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-(diaminomethylidene)-9-methoxy-9-(methoxymethyl)fluorene-2-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-9-methoxy-9-(methoxymethyl)fluorene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118717216 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(diaminomethylidene)-9-methoxy-9-(methoxymethyl)fluorene-2-carboxamide;hydrochloride |
| SMILES | COCC1(OC)c2ccccc2-c2ccc(C(=O)N=C(N)N)cc21.Cl |
| InChI | InChI=1S/C18H19N3O3.ClH/c1-23-10-18(24-2)14-6-4-3-5-12(14)13-8-7-11(9-15(13)18)16(22)21-17(19)20;/h3-9H,10H2,1-2H3,(H4,19,20,21,22);1H |
| InChIKey | DWVUYDWFNYEMJA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|