C16H16ClN3O2 — CID 118706289
N-(diaminomethylidene)-9-hydroxy-8-methyl-9H-fluorene-2-carboxamide;hydrochloride (PubChem CID 118706289) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is N-(diaminomethylidene)-9-hydroxy-8-methyl-9H-fluorene-2-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-9-hydroxy-8-methyl-9H-fluorene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118706289 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-(diaminomethylidene)-9-hydroxy-8-methyl-9H-fluorene-2-carboxamide;hydrochloride |
| SMILES | Cc1cccc2c1C(O)c1cc(C(=O)N=C(N)N)ccc1-2.Cl |
| InChI | InChI=1S/C16H15N3O2.ClH/c1-8-3-2-4-11-10-6-5-9(15(21)19-16(17)18)7-12(10)14(20)13(8)11;/h2-7,14,20H,1H3,(H4,17,18,19,21);1H |
| InChIKey | XXMIBYJNMRUJES-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|