C15H13Cl2N3O2 — CID 118706288
8-chloro-N-(diaminomethylidene)-9-hydroxy-9H-fluorene-2-carboxamide;hydrochloride (PubChem CID 118706288) has the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.19 g/mol. Its IUPAC name is 8-chloro-N-(diaminomethylidene)-9-hydroxy-9H-fluorene-2-carboxamide;hydrochloride.
| Compound Name | 8-chloro-N-(diaminomethylidene)-9-hydroxy-9H-fluorene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118706288 |
| Molecular Formula | C15H13Cl2N3O2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 8-chloro-N-(diaminomethylidene)-9-hydroxy-9H-fluorene-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1ccc2c(c1)C(O)c1c(Cl)cccc1-2 |
| InChI | InChI=1S/C15H12ClN3O2.ClH/c16-11-3-1-2-9-8-5-4-7(14(21)19-15(17)18)6-10(8)13(20)12(9)11;/h1-6,13,20H,(H4,17,18,19,21);1H |
| InChIKey | GRLCBDQYZWQLGS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|