C16H16ClN3O3 — CID 118706291
N-(diaminomethylidene)-9-hydroxy-5-(hydroxymethyl)-9H-fluorene-2-carboxamide;hydrochloride (PubChem CID 118706291) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is N-(diaminomethylidene)-9-hydroxy-5-(hydroxymethyl)-9H-fluorene-2-carboxamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-9-hydroxy-5-(hydroxymethyl)-9H-fluorene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 118706291 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(diaminomethylidene)-9-hydroxy-5-(hydroxymethyl)-9H-fluorene-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1ccc2c(c1)C(O)c1cccc(CO)c1-2 |
| InChI | InChI=1S/C16H15N3O3.ClH/c17-16(18)19-15(22)8-4-5-10-12(6-8)14(21)11-3-1-2-9(7-20)13(10)11;/h1-6,14,20-21H,7H2,(H4,17,18,19,22);1H |
| InChIKey | FZZFZRSSXDRSOC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|