C17H10F3NO2 — CID 59492532
2-ethynyl-9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxamide (PubChem CID 59492532) has the molecular formula C17H10F3NO2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-ethynyl-9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxamide.
| Compound Name | 2-ethynyl-9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxamide |
|---|---|
| PubChem CID | 59492532 |
| Molecular Formula | C17H10F3NO2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-ethynyl-9-hydroxy-9-(trifluoromethyl)fluorene-4-carboxamide |
| SMILES | C#Cc1cc(C(N)=O)c2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C17H10F3NO2/c1-2-9-7-11(15(21)22)14-10-5-3-4-6-12(10)16(23,13(14)8-9)17(18,19)20/h1,3-8,23H,(H2,21,22) |
| InChIKey | UYOFBMVIGMBLBY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|