C17H14F3NO2 — CID 59492643
9-hydroxy-N,N-dimethyl-9-(trifluoromethyl)fluorene-3-carboxamide (PubChem CID 59492643) has the molecular formula C17H14F3NO2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 9-hydroxy-N,N-dimethyl-9-(trifluoromethyl)fluorene-3-carboxamide.
| Compound Name | 9-hydroxy-N,N-dimethyl-9-(trifluoromethyl)fluorene-3-carboxamide |
|---|---|
| PubChem CID | 59492643 |
| Molecular Formula | C17H14F3NO2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 9-hydroxy-N,N-dimethyl-9-(trifluoromethyl)fluorene-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)-c1ccccc1C2(O)C(F)(F)F |
| InChI | InChI=1S/C17H14F3NO2/c1-21(2)15(22)10-7-8-14-12(9-10)11-5-3-4-6-13(11)16(14,23)17(18,19)20/h3-9,23H,1-2H3 |
| InChIKey | NXHBVRKPBUMZGE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |