C24H24N2O8S2 — CID 59501830
[(2Z)-2-[cyano(isocyano)methylidene]-7-(2,5-dimethyl-1,3-dioxane-5-carbonyl)oxy-1,3-benzodithiol-4-yl] 2,5-dimethyl-1,3-dioxane-2-carboxylate (PubChem CID 59501830) has the molecular formula C24H24N2O8S2 and a molecular weight of 532.60 g/mol. Its IUPAC name is [(2Z)-2-[cyano(isocyano)methylidene]-7-(2,5-dimethyl-1,3-dioxane-5-carbonyl)oxy-1,3-benzodithiol-4-yl] 2,5-dimethyl-1,3-dioxane-2-carboxylate.
| Compound Name | [(2Z)-2-[cyano(isocyano)methylidene]-7-(2,5-dimethyl-1,3-dioxane-5-carbonyl)oxy-1,3-benzodithiol-4-yl] 2,5-dimethyl-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 59501830 |
| Molecular Formula | C24H24N2O8S2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | [(2Z)-2-[cyano(isocyano)methylidene]-7-(2,5-dimethyl-1,3-dioxane-5-carbonyl)oxy-1,3-benzodithiol-4-yl] 2,5-dimethyl-1,3-dioxane-2-carboxylate |
| SMILES | [C-]#[N+]/C(C#N)=C1/Sc2c(OC(=O)C3(C)COC(C)OC3)ccc(OC(=O)C3(C)OCC(C)CO3)c2S1 |
| InChI | InChI=1S/C24H24N2O8S2/c1-13-9-31-24(4,32-10-13)22(28)34-17-7-6-16(18-19(17)36-20(35-18)15(8-25)26-5)33-21(27)23(3)11-29-14(2)30-12-23/h6-7,13-14H,9-12H2,1-4H3/b20-15- |
| InChIKey | QGXYRCMPHUDUMS-HKWRFOASSA-N |
| XLogP | 4.11 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|