C34H37O3S+ — CID 59503235
diphenyl-[4-[1-[2-(4-phenylcyclohexyl)oxyethoxy]ethoxy]phenyl]sulfanium (PubChem CID 59503235) has the molecular formula C34H37O3S+ and a molecular weight of 525.73 g/mol. Its IUPAC name is diphenyl-[4-[1-[2-(4-phenylcyclohexyl)oxyethoxy]ethoxy]phenyl]sulfanium.
| Compound Name | diphenyl-[4-[1-[2-(4-phenylcyclohexyl)oxyethoxy]ethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 59503235 |
| Molecular Formula | C34H37O3S+ |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | diphenyl-[4-[1-[2-(4-phenylcyclohexyl)oxyethoxy]ethoxy]phenyl]sulfanium |
| SMILES | CC(OCCOC1CCC(c2ccccc2)CC1)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H37O3S/c1-27(35-25-26-36-30-19-17-29(18-20-30)28-11-5-2-6-12-28)37-31-21-23-34(24-22-31)38(32-13-7-3-8-14-32)33-15-9-4-10-16-33/h2-16,21-24,27,29-30H,17-20,25-26H2,1H3/q+1 |
| InChIKey | OPQAYPDCANMKES-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|