C36H48O6 — CID 90276548
1-[1,4-bis[4-(1-ethoxyethoxy)phenyl]cyclohexyl]-4-(1-ethoxyethoxy)benzene (PubChem CID 90276548) has the molecular formula C36H48O6 and a molecular weight of 576.77 g/mol. Its IUPAC name is 1-[1,4-bis[4-(1-ethoxyethoxy)phenyl]cyclohexyl]-4-(1-ethoxyethoxy)benzene.
| Compound Name | 1-[1,4-bis[4-(1-ethoxyethoxy)phenyl]cyclohexyl]-4-(1-ethoxyethoxy)benzene |
|---|---|
| PubChem CID | 90276548 |
| Molecular Formula | C36H48O6 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | 1-[1,4-bis[4-(1-ethoxyethoxy)phenyl]cyclohexyl]-4-(1-ethoxyethoxy)benzene |
| SMILES | CCOC(C)Oc1ccc(C2CCC(c3ccc(OC(C)OCC)cc3)(c3ccc(OC(C)OCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C36H48O6/c1-7-37-26(4)40-33-16-10-29(11-17-33)30-22-24-36(25-23-30,31-12-18-34(19-13-31)41-27(5)38-8-2)32-14-20-35(21-15-32)42-28(6)39-9-3/h10-21,26-28,30H,7-9,22-25H2,1-6H3 |
| InChIKey | VLDVLTOZRRYKPA-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|