C19H27ClFN3O5 — CID 59504214
tert-butyl (4S,5R)-4-[[5-chloro-2-fluoro-4-(hydrazinecarbonyl)phenoxy]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 59504214) has the molecular formula C19H27ClFN3O5 and a molecular weight of 431.89 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[[5-chloro-2-fluoro-4-(hydrazinecarbonyl)phenoxy]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[[5-chloro-2-fluoro-4-(hydrazinecarbonyl)phenoxy]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 59504214 |
| Molecular Formula | C19H27ClFN3O5 |
| Molecular Weight | 431.89 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | tert-butyl (4S,5R)-4-[[5-chloro-2-fluoro-4-(hydrazinecarbonyl)phenoxy]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1COc1cc(Cl)c(C(=O)NN)cc1F |
| InChI | InChI=1S/C19H27ClFN3O5/c1-10-14(24(19(5,6)28-10)17(26)29-18(2,3)4)9-27-15-8-12(20)11(7-13(15)21)16(25)23-22/h7-8,10,14H,9,22H2,1-6H3,(H,23,25)/t10-,14+/m1/s1 |
| InChIKey | DKKFGPHPXYRVJH-YGRLFVJLSA-N |
| XLogP | 3.22 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|