C18H20ClN3O2 — CID 59504859
tert-butyl 4-chloro-3-(4-cyanophenyl)-1-propan-2-ylpyrazole-5-carboxylate (PubChem CID 59504859) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is tert-butyl 4-chloro-3-(4-cyanophenyl)-1-propan-2-ylpyrazole-5-carboxylate.
| Compound Name | tert-butyl 4-chloro-3-(4-cyanophenyl)-1-propan-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 59504859 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | tert-butyl 4-chloro-3-(4-cyanophenyl)-1-propan-2-ylpyrazole-5-carboxylate |
| SMILES | CC(C)n1nc(-c2ccc(C#N)cc2)c(Cl)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H20ClN3O2/c1-11(2)22-16(17(23)24-18(3,4)5)14(19)15(21-22)13-8-6-12(10-20)7-9-13/h6-9,11H,1-5H3 |
| InChIKey | FSOZMSNFZLKMOX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |