C16H9F3N4O2 — CID 59507125
11-[[2-(trifluoromethyl)phenyl]methyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 59507125) has the molecular formula C16H9F3N4O2 and a molecular weight of 346.27 g/mol. Its IUPAC name is 11-[[2-(trifluoromethyl)phenyl]methyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 11-[[2-(trifluoromethyl)phenyl]methyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 59507125 |
| Molecular Formula | C16H9F3N4O2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 11-[[2-(trifluoromethyl)phenyl]methyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | O=C1c2cnc3[nH]ncc3c2C(=O)N1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H9F3N4O2/c17-16(18,19)11-4-2-1-3-8(11)7-23-14(24)10-5-20-13-9(6-21-22-13)12(10)15(23)25/h1-6H,7H2,(H,20,21,22) |
| InChIKey | FISWQNKHYKFUNZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|