C18H22ClN5O3 — CID 59507455
4-chloro-5-[2-morpholin-4-yl-6-(oxan-4-yloxy)pyrimidin-4-yl]pyridin-2-amine (PubChem CID 59507455) has the molecular formula C18H22ClN5O3 and a molecular weight of 391.86 g/mol. Its IUPAC name is 4-chloro-5-[2-morpholin-4-yl-6-(oxan-4-yloxy)pyrimidin-4-yl]pyridin-2-amine.
| Compound Name | 4-chloro-5-[2-morpholin-4-yl-6-(oxan-4-yloxy)pyrimidin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 59507455 |
| Molecular Formula | C18H22ClN5O3 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-chloro-5-[2-morpholin-4-yl-6-(oxan-4-yloxy)pyrimidin-4-yl]pyridin-2-amine |
| SMILES | Nc1cc(Cl)c(-c2cc(OC3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C18H22ClN5O3/c19-14-9-16(20)21-11-13(14)15-10-17(27-12-1-5-25-6-2-12)23-18(22-15)24-3-7-26-8-4-24/h9-12H,1-8H2,(H2,20,21) |
| InChIKey | KTHMSWKEMIWVNG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |