C33H38N4O5 — CID 59508073
tert-butyl 2-(2-methoxy-3-pyridinyl)-5-(3-morpholin-4-ylpropylcarbamoyl)-3-phenylindole-1-carboxylate (PubChem CID 59508073) has the molecular formula C33H38N4O5 and a molecular weight of 570.69 g/mol. Its IUPAC name is tert-butyl 2-(2-methoxy-3-pyridinyl)-5-(3-morpholin-4-ylpropylcarbamoyl)-3-phenylindole-1-carboxylate.
| Compound Name | tert-butyl 2-(2-methoxy-3-pyridinyl)-5-(3-morpholin-4-ylpropylcarbamoyl)-3-phenylindole-1-carboxylate |
|---|---|
| PubChem CID | 59508073 |
| Molecular Formula | C33H38N4O5 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | tert-butyl 2-(2-methoxy-3-pyridinyl)-5-(3-morpholin-4-ylpropylcarbamoyl)-3-phenylindole-1-carboxylate |
| SMILES | COc1ncccc1-c1c(-c2ccccc2)c2cc(C(=O)NCCCN3CCOCC3)ccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H38N4O5/c1-33(2,3)42-32(39)37-27-14-13-24(30(38)34-16-9-17-36-18-20-41-21-19-36)22-26(27)28(23-10-6-5-7-11-23)29(37)25-12-8-15-35-31(25)40-4/h5-8,10-15,22H,9,16-21H2,1-4H3,(H,34,38) |
| InChIKey | KCGKCKAYMNRGQP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|