About CID 59510583
CID 59510583 (PubChem CID 59510583) has the molecular formula C8H9ClSi
and a molecular weight of 168.70 g/mol.
Molecular Properties
| Compound Name | CID 59510583 |
| PubChem CID | 59510583 |
| Molecular Formula | C8H9ClSi |
| Molecular Weight | 168.70 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | — |
| SMILES | C[Si]c1ccc(CCl)cc1 |
| InChI | InChI=1S/C8H9ClSi/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| InChIKey | LYBOSYBISMRJIR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.70 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59510583 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59510583?
The IUPAC name of CID 59510583 (CID 59510583) is not available.
What is the SMILES notation for CID 59510583?
The canonical SMILES for CID 59510583 is C[Si]c1ccc(CCl)cc1.
What is the InChIKey of CID 59510583?
The InChIKey is LYBOSYBISMRJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClSi/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3.
What are the key properties of CID 59510583?
CID 59510583 has a molecular weight of 168.70 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59510583 is sourced from PubChem (CID 59510583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).