C27H30F3N5OS2 — CID 59512169
N-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-2,2-dimethylpropyl]thiophene-2-carboxamide (PubChem CID 59512169) has the molecular formula C27H30F3N5OS2 and a molecular weight of 561.70 g/mol. Its IUPAC name is N-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-2,2-dimethylpropyl]thiophene-2-carboxamide.
| Compound Name | N-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-2,2-dimethylpropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59512169 |
| Molecular Formula | C27H30F3N5OS2 |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | N-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-2,2-dimethylpropyl]thiophene-2-carboxamide |
| SMILES | [H]/N=N/C(CNC(=O)c1ccc(C(Sc2cc(C)c(-c3ccc(C(F)(F)F)cc3)c(C)c2)C(C)(C)C)s1)=N\N |
| InChI | InChI=1S/C27H30F3N5OS2/c1-15-12-19(13-16(2)23(15)17-6-8-18(9-7-17)27(28,29)30)37-24(26(3,4)5)20-10-11-21(38-20)25(36)33-14-22(34-31)35-32/h6-13,24,31H,14,32H2,1-5H3,(H,33,36)/b34-31+,35-22- |
| InChIKey | OSRPXFINSNWMOT-JXBBDGTASA-N |
| XLogP | 7.96 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|