C26H27F3N4OS2 — CID 89088384
N-(2-diazenyl-2-iminoethyl)-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-2-methylpropyl]thiophene-2-carboxamide (PubChem CID 89088384) has the molecular formula C26H27F3N4OS2 and a molecular weight of 532.66 g/mol. Its IUPAC name is N-(2-diazenyl-2-iminoethyl)-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-2-methylpropyl]thiophene-2-carboxamide.
| Compound Name | N-(2-diazenyl-2-iminoethyl)-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-2-methylpropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 89088384 |
| Molecular Formula | C26H27F3N4OS2 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | N-(2-diazenyl-2-iminoethyl)-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-2-methylpropyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(CNC(=O)c1ccc(C(Sc2cc(C)c(-c3ccc(C(F)(F)F)cc3)c(C)c2)C(C)C)s1)\N=N\[H] |
| InChI | InChI=1S/C26H27F3N4OS2/c1-14(2)24(20-9-10-21(36-20)25(34)32-13-22(30)33-31)35-19-11-15(3)23(16(4)12-19)17-5-7-18(8-6-17)26(27,28)29/h5-12,14,24,30-31H,13H2,1-4H3,(H,32,34)/b30-22-,33-31+ |
| InChIKey | RCIVDRWBWGTPIP-IJTKJODBSA-N |
| XLogP | 8.28 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|