C28H32F3N5OS2 — CID 59512170
N-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-3,3-dimethylbutyl]thiophene-2-carboxamide (PubChem CID 59512170) has the molecular formula C28H32F3N5OS2 and a molecular weight of 575.73 g/mol. Its IUPAC name is N-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-3,3-dimethylbutyl]thiophene-2-carboxamide.
| Compound Name | N-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-3,3-dimethylbutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59512170 |
| Molecular Formula | C28H32F3N5OS2 |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | N-[(2Z)-2-diazenyl-2-hydrazinylideneethyl]-5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanyl-3,3-dimethylbutyl]thiophene-2-carboxamide |
| SMILES | [H]/N=N/C(CNC(=O)c1ccc(C(CC(C)(C)C)Sc2cc(C)c(-c3ccc(C(F)(F)F)cc3)c(C)c2)s1)=N\N |
| InChI | InChI=1S/C28H32F3N5OS2/c1-16-12-20(13-17(2)25(16)18-6-8-19(9-7-18)28(29,30)31)38-23(14-27(3,4)5)21-10-11-22(39-21)26(37)34-15-24(35-32)36-33/h6-13,23,32H,14-15,33H2,1-5H3,(H,34,37)/b35-32+,36-24- |
| InChIKey | NGOJNUODDKEKGL-ZFGDVNIPSA-N |
| XLogP | 8.35 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|