C10H10Cl2N2 — CID 59514266
5,7-dichloro-3-ethyl-2-methylindazole (PubChem CID 59514266) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is 5,7-dichloro-3-ethyl-2-methylindazole.
| Compound Name | 5,7-dichloro-3-ethyl-2-methylindazole |
|---|---|
| PubChem CID | 59514266 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 5,7-dichloro-3-ethyl-2-methylindazole |
| SMILES | CCc1c2cc(Cl)cc(Cl)c2nn1C |
| InChI | InChI=1S/C10H10Cl2N2/c1-3-9-7-4-6(11)5-8(12)10(7)13-14(9)2/h4-5H,3H2,1-2H3 |
| InChIKey | KFILJGYEBRZURY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |