C20H17ClF3N3O — CID 59516185
2-chloro-4-[[(3S)-1-ethyl-5-oxopyrrolidin-3-yl]-[(2,3,5-trifluorophenyl)methyl]amino]benzonitrile (PubChem CID 59516185) has the molecular formula C20H17ClF3N3O and a molecular weight of 407.82 g/mol. Its IUPAC name is 2-chloro-4-[[(3S)-1-ethyl-5-oxopyrrolidin-3-yl]-[(2,3,5-trifluorophenyl)methyl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[[(3S)-1-ethyl-5-oxopyrrolidin-3-yl]-[(2,3,5-trifluorophenyl)methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 59516185 |
| Molecular Formula | C20H17ClF3N3O |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-chloro-4-[[(3S)-1-ethyl-5-oxopyrrolidin-3-yl]-[(2,3,5-trifluorophenyl)methyl]amino]benzonitrile |
| SMILES | CCN1C[C@@H](N(Cc2cc(F)cc(F)c2F)c2ccc(C#N)c(Cl)c2)CC1=O |
| InChI | InChI=1S/C20H17ClF3N3O/c1-2-26-11-16(8-19(26)28)27(15-4-3-12(9-25)17(21)7-15)10-13-5-14(22)6-18(23)20(13)24/h3-7,16H,2,8,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | BMELTLLCWMAQQQ-INIZCTEOSA-N |
| XLogP | 4.26 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|