C19H17ClF3N3O — CID 89021377
2-chloro-4-[[(2S)-1-(methylamino)-4-oxobutan-2-yl]-[(2,3,5-trifluorophenyl)methyl]amino]benzonitrile (PubChem CID 89021377) has the molecular formula C19H17ClF3N3O and a molecular weight of 395.81 g/mol. Its IUPAC name is 2-chloro-4-[[(2S)-1-(methylamino)-4-oxobutan-2-yl]-[(2,3,5-trifluorophenyl)methyl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[[(2S)-1-(methylamino)-4-oxobutan-2-yl]-[(2,3,5-trifluorophenyl)methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 89021377 |
| Molecular Formula | C19H17ClF3N3O |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-chloro-4-[[(2S)-1-(methylamino)-4-oxobutan-2-yl]-[(2,3,5-trifluorophenyl)methyl]amino]benzonitrile |
| SMILES | CNC[C@H](CC=O)N(Cc1cc(F)cc(F)c1F)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C19H17ClF3N3O/c1-25-10-16(4-5-27)26(15-3-2-12(9-24)17(20)8-15)11-13-6-14(21)7-18(22)19(13)23/h2-3,5-8,16,25H,4,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | AWSKXXOTFNQTEC-INIZCTEOSA-N |
| XLogP | 3.81 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|