C23H27Cl2N3 — CID 143480571
2-chloro-4-[(2-chlorophenyl)methyl-[1-[[(E)-2-methylbut-2-enyl]amino]butan-2-yl]amino]benzonitrile (PubChem CID 143480571) has the molecular formula C23H27Cl2N3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-chloro-4-[(2-chlorophenyl)methyl-[1-[[(E)-2-methylbut-2-enyl]amino]butan-2-yl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[(2-chlorophenyl)methyl-[1-[[(E)-2-methylbut-2-enyl]amino]butan-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 143480571 |
| Molecular Formula | C23H27Cl2N3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-chloro-4-[(2-chlorophenyl)methyl-[1-[[(E)-2-methylbut-2-enyl]amino]butan-2-yl]amino]benzonitrile |
| SMILES | C/C=C(\C)CNCC(CC)N(Cc1ccccc1Cl)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C23H27Cl2N3/c1-4-17(3)14-27-15-20(5-2)28(16-19-8-6-7-9-22(19)24)21-11-10-18(13-26)23(25)12-21/h4,6-12,20,27H,5,14-16H2,1-3H3/b17-4+ |
| InChIKey | NGFHUTQCLLYWCO-HAVNEIBRSA-N |
| XLogP | 6.21 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|