C20H20N6O2 — CID 59516503
4-(4-acetylpiperazin-1-yl)-11-methyl-1,3,5,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaen-8-one (PubChem CID 59516503) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-11-methyl-1,3,5,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaen-8-one.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-11-methyl-1,3,5,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaen-8-one |
|---|---|
| PubChem CID | 59516503 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-11-methyl-1,3,5,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,9,12,14,16-heptaen-8-one |
| SMILES | CC(=O)N1CCN(c2ncc3c(=O)cc4n(C)c5ccccc5n4c3n2)CC1 |
| InChI | InChI=1S/C20H20N6O2/c1-13(27)24-7-9-25(10-8-24)20-21-12-14-17(28)11-18-23(2)15-5-3-4-6-16(15)26(18)19(14)22-20/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | PVOAWJUMNPMJEU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |