C16H12N4O2S — CID 141140932
11-methyl-4-methylsulfanyl-1,3,5,11-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-2,4,6,9,13,15,17-heptaene-8,12-dione (PubChem CID 141140932) has the molecular formula C16H12N4O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 11-methyl-4-methylsulfanyl-1,3,5,11-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-2,4,6,9,13,15,17-heptaene-8,12-dione.
| Compound Name | 11-methyl-4-methylsulfanyl-1,3,5,11-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-2,4,6,9,13,15,17-heptaene-8,12-dione |
|---|---|
| PubChem CID | 141140932 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 11-methyl-4-methylsulfanyl-1,3,5,11-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-2,4,6,9,13,15,17-heptaene-8,12-dione |
| SMILES | CSc1ncc2c(=O)cc3n(C)c(=O)c4ccccc4n3c2n1 |
| InChI | InChI=1S/C16H12N4O2S/c1-19-13-7-12(21)10-8-17-16(23-2)18-14(10)20(13)11-6-4-3-5-9(11)15(19)22/h3-8H,1-2H3 |
| InChIKey | NROUPSDSRKTHES-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|