C19H30N2O4 — CID 59519778
tert-butyl (2S)-2-[(3-amino-2-hydroxyhexanoyl)amino]-3-phenylpropanoate (PubChem CID 59519778) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3-amino-2-hydroxyhexanoyl)amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[(3-amino-2-hydroxyhexanoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 59519778 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl (2S)-2-[(3-amino-2-hydroxyhexanoyl)amino]-3-phenylpropanoate |
| SMILES | CCCC(N)C(O)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O4/c1-5-9-14(20)16(22)17(23)21-15(18(24)25-19(2,3)4)12-13-10-7-6-8-11-13/h6-8,10-11,14-16,22H,5,9,12,20H2,1-4H3,(H,21,23)/t14?,15-,16?/m0/s1 |
| InChIKey | DAERGJPIWDBRDT-PCKAHOCUSA-N |
| XLogP | 1.54 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |