C12H19NO5 — CID 59532853
propan-2-yl 4-oxo-4-(2-prop-2-enoyloxyethylamino)butanoate (PubChem CID 59532853) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is propan-2-yl 4-oxo-4-(2-prop-2-enoyloxyethylamino)butanoate.
| Compound Name | propan-2-yl 4-oxo-4-(2-prop-2-enoyloxyethylamino)butanoate |
|---|---|
| PubChem CID | 59532853 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | propan-2-yl 4-oxo-4-(2-prop-2-enoyloxyethylamino)butanoate |
| SMILES | C=CC(=O)OCCNC(=O)CCC(=O)OC(C)C |
| InChI | InChI=1S/C12H19NO5/c1-4-11(15)17-8-7-13-10(14)5-6-12(16)18-9(2)3/h4,9H,1,5-8H2,2-3H3,(H,13,14) |
| InChIKey | OPJIKXNZJUIEMO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|