C15H24N2O7 — CID 20659321
2-prop-2-enoyloxyethyl 4-[[2-[2-(dimethylamino)ethoxy]-2-oxoethyl]amino]-4-oxobutanoate (PubChem CID 20659321) has the molecular formula C15H24N2O7 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 4-[[2-[2-(dimethylamino)ethoxy]-2-oxoethyl]amino]-4-oxobutanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 4-[[2-[2-(dimethylamino)ethoxy]-2-oxoethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 20659321 |
| Molecular Formula | C15H24N2O7 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 4-[[2-[2-(dimethylamino)ethoxy]-2-oxoethyl]amino]-4-oxobutanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)NCC(=O)OCCN(C)C |
| InChI | InChI=1S/C15H24N2O7/c1-4-13(19)23-9-10-24-14(20)6-5-12(18)16-11-15(21)22-8-7-17(2)3/h4H,1,5-11H2,2-3H3,(H,16,18) |
| InChIKey | FKBZLAXBZVGWSY-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|